On Target P2RX3_HUMAN 0.1368421/CHEMBL3897696
For the given ligand fff, we have found in our database that, being scored 0.1368421, the most similar ligand is CHEMBL3897696. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL3897696 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | CC(C)Oc1ccc(Nc2nc(=O)n(CCO)c(=O)[nH]2)cc1F |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 04000002 00000008 a0100008 02000600 01001000 00008010 02001000 00000808 04000102 00004860 0020000c 60049000 04818022 00401000 01000041 1008000c 00040840 10004000 08400008 10220000 c0000000 38000040 63004000 04600014 40000000 80000000 40044000 000000a1 0800c208 00468000 c0000000 00000200 |