On Target MDR1_HUMAN 0.22033899/CHEMBL2398175
For the given ligand fff, we have found in our database that, being scored 0.22033899, the most similar ligand is CHEMBL2398175. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL2398175 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | CC1(C)[C@@H](O)CC[C@@]2(C)[C@H]1CC[C@]1(C)[C@@H]2C[C@@H](O)[C@@H]2[C@@H]([C@@](C)(O)CCCNCc3ccc(F)cc3)CC[C@]21C |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 00000000 01000000 00100100 02010600 00380000 00000010 00000000 22001000 00000000 000008c0 00200000 40018000 00000802 00801000 00000400 00080008 00000000 02000100 02402000 00100201 00000000 18008010 01000000 00500010 00000000 c0000000 00000000 90000001 00000100 01068000 20060000 00000a00 |