On Target OPRM_MOUSE 0.12307692/CHEMBL151416
For the given ligand fff, we have found in our database that, being scored 0.12307692, the most similar ligand is CHEMBL151416. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL151416 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | C[C@H]1CN(Cc2ccccc2)CCN1C(c1ccc(C(C)(C)C)cc1)c1cccc(O)c1 |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 00000000 46000008 20100100 04010600 00000000 00000000 02000000 03001000 00000100 00090840 08200000 40008800 80000802 00002000 00000400 00000008 00000000 02000000 00000000 00020200 00000000 38008000 00000021 02460010 00000000 e0000000 00000000 c0000000 08000180 00060002 20040000 00000600 |