On Target SCN9A_HUMAN 0.1969697/CHEMBL287833
For the given ligand fff, we have found in our database that, being scored 0.1969697, the most similar ligand is CHEMBL287833. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL287833 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | NC(=O)N/N=C/c1ccc(Oc2ccc(F)cc2)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 00000008 00000008 20100108 02010a00 00003000 00000010 02040001 01084000 00000100 00000841 00000000 40008000 80008002 00001000 01000001 00080008 00000000 02000000 00002400 00420800 00480000 08000400 40041002 00400000 00000000 80000800 40020000 00200001 00000208 000e8002 40200c00 00000200 |