On Target CXCR1_HUMAN 0.13131313/CHEMBL3609011
For the given ligand fff, we have found in our database that, being scored 0.13131313, the most similar ligand is CHEMBL3609011. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL3609011 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | CN(Cc1ccc(B(O)O)cc1)c1ncc(C(=O)Nc2ccc(F)cc2)cn1 |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 10004002 01000000 00100182 02018610 01000000 00004010 00006000 02001000 00000180 20000840 40288004 6000c000 40008800 00101000 00000940 000c0004 00040000 03004000 08400000 40a00000 c0100000 0c008e00 20812840 00600008 00040000 c0000080 00000000 80000081 0000811c 00468801 c0041000 800002a0 |