On Target DRD4_HUMAN 0.22033899/CHEMBL277937
For the given ligand fff, we have found in our database that, being scored 0.22033899, the most similar ligand is CHEMBL277937. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL277937 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | CC(C)(C)C(=O)NCCCCN1CCN(c2ccc(F)cc2)CC1 |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 00004002 00001000 00100020 06000600 01000000 00000010 00000000 20000000 00200000 00000ac0 00200004 40029000 00008002 00003000 00000040 00000000 00040000 00000000 08000000 00200201 40100000 38040600 20000021 0200001a 00000000 00000000 00000000 10000081 08008000 00068001 00000000 00002200 |