On Target PGH2_HUMAN 0.27659574/CHEMBL490482
For the given ligand fff, we have found in our database that, being scored 0.27659574, the most similar ligand is CHEMBL490482. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL490482 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | Oc1cc(O)cc(/C=C/c2cccc(F)c2)c1 |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 00000001 40000008 20100180 02010200 00000000 00000010 82000080 00000400 00000000 00002840 00000100 50108000 00000002 00001000 00000002 00000008 00000400 02000000 00000000 00020a00 00000000 18000000 00000800 00400000 00000000 80000000 00402000 40000001 00400000 00028100 04000000 00000200 |