On Target ACE_HUMAN 0.15116279/CHEMBL467755
For the given ligand fff, we have found in our database that, being scored 0.15116279, the most similar ligand is CHEMBL467755. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL467755 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | C[C@H](CS)C(=O)N[C@@H](CSCc1ccc(F)cc1)C(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 00000002 40004000 20122528 0a110600 00000080 00000010 00000000 00000000 00400000 02024840 00200000 4000b000 02019006 40041100 80080000 00080008 14000008 02000100 00000000 00501300 40000000 18000e00 03000600 04400018 00040200 80000000 00004000 00000001 00001000 00068021 20404000 03010200 |