On Target OPRD_HUMAN 0.19402985/CHEMBL340834
For the given ligand fff, we have found in our database that, being scored 0.19402985, the most similar ligand is CHEMBL340834. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL340834 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | CCN(CC)C(=O)c1ccc(C(c2cccc(F)c2)N2CCNCC2)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 00000000 00000800 00100100 46010600 00000000 00000010 00000000 03001000 00000100 00092840 08200000 50008800 80008802 00003000 00000430 00000000 00000000 02000000 00000000 00000000 00000000 28028600 00000020 0240001c 00000000 e0000001 80000000 c0000001 08000180 00068003 80040000 00000600 |