On Target NTRK1_HUMAN 0.19117647/CHEMBL1976290
For the given ligand fff, we have found in our database that, being scored 0.19117647, the most similar ligand is CHEMBL1976290. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL1976290 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | Cc1cc(-c2ccc3c(c2)CNC3=O)ccc1F |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 00002000 00800800 00100100 52010600 00800001 04008010 10000000 02001000 00000100 00000840 00200000 40008000 80008802 00201000 00000400 00000008 00022200 02001000 04000000 10100000 80000000 08028680 10000000 0040000c 00000000 c0200000 08000000 80000041 00004100 00068001 80040000 00000200 |