On Target MTOR_HUMAN 0.13131313/CHEMBL3701140
For the given ligand fff, we have found in our database that, being scored 0.13131313, the most similar ligand is CHEMBL3701140. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL3701140 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | Cc1nc(N)ccc1C#Cc1c(-c2cccc(F)c2)ccnc1C |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 10002202 00024809 00104980 12010210 01443020 00000010 00000200 00000000 02000000 00002840 40010004 70008004 80008800 00209000 21020000 0204000c 00020000 22009004 04200000 00200000 40000000 0c828200 30800801 02600008 00040004 80000000 088002c0 00000049 0240400c 00068000 00000000 00000320 |