On Target OPRX_HUMAN 0.22033899/CHEMBL2112346
For the given ligand fff, we have found in our database that, being scored 0.22033899, the most similar ligand is CHEMBL2112346. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL2112346 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | CC(C)[C@H]1CC[C@@H](N2CCC3(CC2)[C@@H]2CN(CC4CC4)C[C@@H]2CN3c2ccc(F)cc2)CC1 |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 00004002 01000400 00100000 02000600 21000000 00002010 00000000 20000000 00200000 000009e0 00200004 50038000 00000002 01001000 00020040 00000000 00040000 00000000 0a002000 00200201 60100000 18000030 20000000 00100010 00000000 00000000 00000000 10000081 00008000 00068010 00020000 00002200 |