On Target CDK5_HUMAN 0.18571429/CHEMBL1971519
For the given ligand fff, we have found in our database that, being scored 0.18571429, the most similar ligand is CHEMBL1971519. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL1971519 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | Nc1n[nH]c2cccc(-c3ccc(F)cc3)c12 |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 00002003 00000008 20100100 02010200 00840004 00000010 02000000 00000000 00000000 10000840 00000004 60008000 00000012 00401000 00000040 0004400c 00020000 02000000 04600000 00320000 40000000 0c000008 30800800 00600008 00160000 80080000 00060240 00000041 00004008 00068000 00000000 00004260 |