On Target 5HT2C_HUMAN 0.30232558/CHEMBL493130
For the given ligand fff, we have found in our database that, being scored 0.30232558, the most similar ligand is CHEMBL493130. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL493130 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | Cl.NC[C@H]1C[C@@H]1c1ccc(F)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 00000000 01000200 00100102 02010600 00000000 00000010 00000000 00000000 00100800 000808c0 08100000 40018000 00000000 01201000 00000000 00000000 00000000 02000080 00000000 00100001 00000100 18000000 00000000 00400010 00000000 80000000 00000000 00000001 00000000 0006800a 00000000 00020600 |