On Target MIF_HUMAN 0.18055555/CHEMBL223198
For the given ligand fff, we have found in our database that, being scored 0.18055555, the most similar ligand is CHEMBL223198. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL223198 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | COc1ccc(N/N=C/c2ccc(O)c(F)c2)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 0000200a 00000008 20100108 02030200 00001000 04000010 02000000 01004008 00000100 00002841 00000004 50008000 80000042 00001000 01010041 00084008 00000800 02000000 00000400 00220000 40080000 1c000000 70041802 00600000 00000000 80000800 40060000 00000001 00000208 000e8000 40000000 00000200 |