On Target IKKB_HUMAN 0.18055555/CHEMBL21156
For the given ligand fff, we have found in our database that, being scored 0.18055555, the most similar ligand is CHEMBL21156. Check out the elaboration below.
| fff (Given Ligand) | CHEMBL21156 (Similar Ligand) |
|---|---|
| Fc1ccccc1 | CC(C)(C)c1nc2c3ccc(F)cc3c3c(=O)[nH]ccc3c2[nH]1 |
|
|
|
|
|
|
| 00000000 00000000 00100000 02000200 00000000 00000010 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00001000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00028000 00000000 00000200 | 0000000a 00000000 00104400 12000200 000c0060 00004070 00000000 00000400 06000100 c0000860 05008004 40808000 00008800 00e01000 00120040 020c0004 00000000 00000000 00200000 00000000 40000000 08008028 21800000 80100010 02000000 40000000 00000000 00000001 00000004 00438800 40040000 20000680 |