On Target NMDE2_HUMAN 0.5058824/CHEMBL4636728
For the given ligand PSPP 30, we have found in our database that, being scored 0.5058824, the most similar ligand is CHEMBL4636728. Check out the elaboration below.
| PSPP 30 (Given Ligand) | CHEMBL4636728 (Similar Ligand) |
|---|---|
| O=C(NC2CCC1(CCCC1)CC2)c4ccc(c3ccccc3)cc4 | Cc1ccc(CN2CCCN(C(=O)c3ccccc3)CC2)c(C)c1 |
|
|
|
|
|
|
| 00002000 01001800 00100100 40010600 00000000 00000000 00000000 22001000 00000100 000008c0 00200000 40018000 80008802 00000000 00000400 00000000 00020000 02000000 06002000 10000201 00000000 18068610 10000000 0050001c 00000000 c0000000 00000000 90000040 00004100 01060001 a0060000 00000200 | 00000000 00003c00 00100100 14010600 00000001 00000000 00000000 02001008 00000100 00010960 00200000 40008000 80008802 00202000 00000400 00000008 00000000 02000000 00000000 00000200 08020000 380a8600 00000001 0240001c 00000000 c0000000 00004000 80000000 08000100 00060011 a0040000 00000200 |