On Target TLR4_HUMAN 0.41379312/CHEMBL4173765
For the given ligand PSPP 30, we have found in our database that, being scored 0.41379312, the most similar ligand is CHEMBL4173765. Check out the elaboration below.
| PSPP 30 (Given Ligand) | CHEMBL4173765 (Similar Ligand) |
|---|---|
| O=C(NC2CCC1(CCCC1)CC2)c4ccc(c3ccccc3)cc4 | Cc1ccc(CNC(=O)CCN2C(=O)C3C4c5ccccc5C(c5ccccc54)C3C2=O)cc1 |
|
|
|
|
|
|
| 00002000 01001800 00100100 40010600 00000000 00000000 00000000 22001000 00000100 000008c0 00200000 40018000 80008802 00000000 00000400 00000000 00020000 02000000 06002000 10000201 00000000 18068610 10000000 0050001c 00000000 c0000000 00000000 90000040 00004100 01060001 a0060000 00000200 | 00030000 01801600 00100102 00010600 00000000 00000012 11000400 23001001 00100900 000809e0 08300000 40019000 8c008802 00200000 00000420 02040000 00000200 02000001 00102018 00000201 80020100 180c8600 00004000 00500018 00001800 e0000001 00000000 d0000000 02000182 0006001b 20040000 00c02600 |