On Target AOFA_HUMAN 0.47126436/CHEMBL4292597
For the given ligand VBJ103, we have found in our database that, being scored 0.47126436, the most similar ligand is CHEMBL4292597. Check out the elaboration below.
| VBJ103 (Given Ligand) | CHEMBL4292597 (Similar Ligand) |
|---|---|
| O=C(NC2CCC1(CCCC1)CC2)c4ccc(c3ccccc3)cc4 | c1ccc(-c2cccc(CN[C@H]3C[C@@H]3c3ccccc3)c2)cc1 |
|
|
|
|
|
|
| 00002000 01001800 00100100 40010600 00000000 00000000 00000000 22001000 00000100 000008c0 00200000 40018000 80008802 00000000 00000400 00000000 00020000 02000000 06002000 10000201 00000000 18068610 10000000 0050001c 00000000 c0000000 00000000 90000040 00004100 01060001 a0060000 00000200 | 00002000 00000200 00100100 00010600 00000001 04000000 10000000 22001000 00000880 000808c0 08300000 40008000 00000802 01000000 00000400 00040008 00020000 02001000 04000000 00000201 00000100 18208000 10000000 81400010 00000000 c0000000 08000000 90000041 04004100 0006000a 20040000 00000600 |