On Target NMDZ1_HUMAN 0.41245136/CHEMBL162577
For the given ligand ghj456, we have found in our database that, being scored 0.41245136, the most similar ligand is CHEMBL162577. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL162577 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | COc1ccc(N2C(=O)CN(Cc3c(C(=O)O)[nH]c4cc(Cl)cc(Cl)c34)C2=O)cc1 |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 1001c006 09802808 20000128 14010e10 000c1020 0000c020 06004084 0a003009 00000300 00090a48 01280004 4000a800 060088ae 0070a400 810204c1 020c000c 0006c008 02c0200c 08200040 00020001 c0120100 28078fe8 20822002 8240011e 00146000 c0000400 08044000 80000080 08008304 00060001 e004c200 80424220 |