On Target ACES_HUMAN 0.49019608/CHEMBL4213591
For the given ligand ghj456, we have found in our database that, being scored 0.49019608, the most similar ligand is CHEMBL4213591. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL4213591 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | COc1ccc(Cn2cc(C(=O)NCCCCCCCNc3c4c(nc5cc(Cl)ccc35)CCCC4)c(=O)c3ccccc32)cc1 |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 1001c00a 0180da08 6010410a 10810610 200c1122 00002060 0b04e000 22001001 12500801 c00808d0 09308004 40818800 02009826 00600800 01020441 0204000e 00068200 8600400c 08202408 00020201 c4100100 18068f18 20804000 8150001c 00046000 c0000001 08a28040 90041080 04488306 0086004b e00e0080 a0420640 |