On Target PDE5A_HUMAN 0.506383/CHEMBL4084966
For the given ligand ghj456, we have found in our database that, being scored 0.506383, the most similar ligand is CHEMBL4084966. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL4084966 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | COc1ccc(CNc2c3c(nc4ccc(C)cc24)CCN(C(C)=O)C3)cc1Cl |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 1400c00a 09809808 60104128 10010610 00041021 00100040 0604c000 0200100c 10400080 20080a58 09208004 4080c800 02008886 00609000 810205c1 0204000c 00060200 0b000026 08200000 00820200 c4120000 18248f08 20814000 81440018 00043000 c0008800 0822c040 80001080 04408304 00060003 20040000 e0020640 |