On Target TRPV1_RAT 0.44813278/CHEMBL438345
For the given ligand ghj456, we have found in our database that, being scored 0.44813278, the most similar ligand is CHEMBL438345. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL438345 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | Cn1c2c(c3cc(O)ccc31)C(CNC(=O)c1ccc(OC(F)(F)F)cc1)CCC2 |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 0000000a 01005808 2010110b 51810610 00045130 00000002 07042000 22001105 00400880 000908c0 08308004 40c18000 18008806 00608800 01020441 0a04000c 00000200 86800004 00202408 00020201 40100100 18268618 20804009 9150041c 00042000 c0000001 08320000 d0000080 06000306 00860043 a0040200 20000620 |