On Target FABP5_HUMAN 0.33953488/CHEMBL4278244
For the given ligand ghj456, we have found in our database that, being scored 0.33953488, the most similar ligand is CHEMBL4278244. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL4278244 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | CC(=O)Nc1ccc2c(OC(=O)[C@H]3[C@@H](c4ccccc4)[C@H](C(=O)O)[C@@H]3c3ccccc3)cccc2c1 |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 04014002 01000008 2000010a 00010700 00081000 02000000 02000000 00000000 00000800 000a0840 08380004 40009000 0480802a 02b00010 11010041 000a2008 00860000 02000000 08402008 00020401 40100100 08000e08 31002040 00400010 00000800 80000000 00000000 00000080 00008202 00060003 00000000 10000600 |