On Target SC6A4_HUMAN 0.46058092/CHEMBL247669
For the given ligand ghj456, we have found in our database that, being scored 0.46058092, the most similar ligand is CHEMBL247669. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL247669 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | CC(C)N1CCC(COc2cc3c(cn2)C(c2ccc(Cl)c(Cl)c2)CNC3)CC1 |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 0c00800a 45004818 20104109 11010710 80141020 02008100 04042400 21005000 00410280 000908c4 08240004 50018800 828008a6 00200080 b1000501 001c208c 10010008 02000024 00680400 00020201 40020040 18208500 21804000 915c8010 00046000 e0100000 08160200 d0002000 07400380 00060002 a0008000 04020e20 |