On Target ADRB2_HUMAN 0.47186148/CHEMBL2012522
For the given ligand ghj456, we have found in our database that, being scored 0.47186148, the most similar ligand is CHEMBL2012522. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL2012522 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | CC(C)(Cc1ccc(Oc2ccc(C(N)=O)cn2)cc1)NC[C@H](O)COc1cccc2[nH]c3ccccc3c12.O=C(O)CCC(=O)O |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 04040002 00808818 2010410b 00010610 80241080 02000100 060c4400 00405008 00000880 00080850 09300004 40009000 04808806 00400000 21280341 001c200c 10200000 02000004 00e02000 00060201 c1420100 18248e08 27800080 8940001c 00042001 80000000 08320000 10a02000 04400222 00060002 80040600 84202640 |