On Target PPARG_HUMAN 0.4801762/CHEMBL235143
For the given ligand ghj456, we have found in our database that, being scored 0.4801762, the most similar ligand is CHEMBL235143. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL235143 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | Cc1cc(Oc2cccc(CNC(=O)c3[nH]c4ccc(Cl)cc4c3C)c2)ccc1CCC(=O)O |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 00008002 44808808 20000108 10010e10 00041020 00108000 07041000 02003001 00000800 00080840 08390004 40009800 0600880e 00708000 01020441 020c010c 00002000 02000006 00682008 00020201 c0420100 08068f08 21806040 8044801c 00146800 c0000001 08164000 80200000 00000384 00060003 80040600 00024620 |