On Target CHLE_HUMAN 0.47777778/CHEMBL3215768
For the given ligand ghj456, we have found in our database that, being scored 0.47777778, the most similar ligand is CHEMBL3215768. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL3215768 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | Cl.Cl.Cl.Cl.O=C(NCCCCCCCCNc1c2c(nc3cc(Cl)ccc13)CCCC2)c1ccc2nc(-c3ccc(Cl)cc3)c3c(c2c1)OCCC3 |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 0401e00a 4100d819 6010410b 10810710 200e1121 02002040 0b04b000 22081209 10400800 100808d0 08308004 40818840 02808806 00600880 31020441 020c200e 00068240 0600a00c 0c682408 00461201 44100100 18068718 31804040 8050001c 00846001 c0000001 08268040 900010c0 0048c306 00860403 a0061880 23660640 |