On Target PDE4B_HUMAN 0.46666667/CHEMBL290191
For the given ligand ghj456, we have found in our database that, being scored 0.46666667, the most similar ligand is CHEMBL290191. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL290191 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | COc1ccc(C2CCN(C(=O)c3cc4ccccc4[nH]3)C2)cc1OC1CCCC1 |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 04000002 43009a08 20100108 10210f00 000c1020 c2100010 02040000 22003005 00000880 000808c0 08390004 40008000 0080c802 20500080 11020441 020ca10c 00800000 02000006 00680000 00020201 40000100 18278608 21802000 8140001c 00100000 c0000000 00120000 90000000 04000304 0106000b a0040200 00004640 |