On Target ACM4_HUMAN 0.46096656/CHEMBL105160
For the given ligand ghj456, we have found in our database that, being scored 0.46096656, the most similar ligand is CHEMBL105160. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL105160 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | CCCCCCc1[nH]c2ccc3c(c2c1C(=O)OCC)CN1CCc2cc(OC)ccc2C1O3 |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 0400000a 4380d808 6010010b 90010610 00041030 8000c500 171c0000 22021404 14400b80 00180c40 48308004 40808800 80808886 2061a000 01020461 0a1e200c 00022209 06088024 0029200a 40020201 c0520d40 18228a78 20804000 81c0301c 00046400 c0012223 086a4040 80000080 04400307 00860002 e4068204 20000620 |