On Target HPGDS_HUMAN 0.43378997/CHEMBL3425959
For the given ligand ghj456, we have found in our database that, being scored 0.43378997, the most similar ligand is CHEMBL3425959. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL3425959 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | O=C(NC1CCN(CC(F)(F)F)CC1)c1ccc(Oc2ccccc2)nc1 |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 10000002 01809c18 2010410b 00000610 80041000 00000140 06044400 22405000 00000000 800009f0 01200004 50018000 00008802 00400000 21000701 0014000c 10020000 02000004 00202000 00020201 c1420000 180c8e00 20800000 0070001c 00040000 40000000 08220000 90202000 00400320 00060011 a0000400 84000200 |