On Target NOS1_HUMAN 0.36199096/CHEMBL1221659
For the given ligand ghj456, we have found in our database that, being scored 0.36199096, the most similar ligand is CHEMBL1221659. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL1221659 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | Cc1cc(N)nc(CCNC(=O)c2ccc(C#N)cc2)c1 |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 0400000a 00001800 00104120 50010600 01041024 00000000 00000000 0200100c 00000180 008c0a40 08208004 40808000 80008802 00008000 01020400 020c000c 00400000 0a000000 00a00000 00200200 40000000 1c228600 28800c00 8160001c 00041000 c0000000 000000c0 80000000 0440010c 00060403 a0040000 20000620 |