On Target OPRK_HUMAN 0.48518518/CHEMBL3086752
For the given ligand ghj456, we have found in our database that, being scored 0.48518518, the most similar ligand is CHEMBL3086752. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL3086752 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | Cl.O=C(N[C@@]12CCC(=O)[C@@H]3Oc4c(O)ccc5c4[C@@]31CCN(CC1CC1)[C@@H]2C5)c1cnc2ccccc2c1 |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 14031002 4380ba08 2010450a 04210710 001c1061 c2000002 07004000 2200124d 00250880 000918c0 09340004 5083d0c0 0480c81a 21e02080 11040461 020ca01c 98a20200 a2008004 06e82008 00020201 c0000100 38368e18 21804081 8350041c 00040801 c0000001 08120208 90000000 0c400302 0006c80b a0060000 80822e40 |