On Target P2RX3_HUMAN 0.459854/CHEMBL3679825
For the given ligand ghj456, we have found in our database that, being scored 0.459854, the most similar ligand is CHEMBL3679825. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL3679825 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | CC(C)C(=O)C1C(=O)C(=O)N(c2ccc(-c3ccoc3)cc2)C1c1cccnc1OCCCO |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 1403e002 01a0d818 2018410a 00a10611 a0041101 82002110 04006000 22201604 04534b00 011808c0 0d3c0004 5001f040 4e808c0a 00308a00 a1120741 005c200c 10060000 22008005 0d602418 00020201 c0120140 18068e10 31812000 06580418 00041800 c0004080 08000010 988000c0 0040c302 02064003 a4005000 84c00600 |