On Target MDR1_HUMAN 0.48161766/CHEMBL772
For the given ligand ghj456, we have found in our database that, being scored 0.48161766, the most similar ligand is CHEMBL772. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL772 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | COC(=O)[C@H]1[C@H]2C[C@@H]3c4[nH]c5cc(OC)ccc5c4CCN3C[C@H]2C[C@@H](OC(=O)c2cc(OC)c(OC)c(OC)c2)[C@@H]1OC |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 0005000b 4900c808 a010050b 51010f10 003c1030 00304002 47042000 22003049 00402980 010908c8 08318004 50819000 1400c89a 01e18000 01024465 220c910c 00820200 06000126 13682408 00060a01 40120120 18238a38 25804000 99500014 00142400 c0002001 084a4200 900000a0 04000306 0086000a e0060200 22246e20 |