On Target AGTR2_HUMAN 0.41218638/CHEMBL424004
For the given ligand ghj456, we have found in our database that, being scored 0.41218638, the most similar ligand is CHEMBL424004. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL424004 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | Cc1cc(Cn2cnc3c2C[C@@H](C(=O)O)N(C(=O)C(c2ccccc2)c2ccccc2)C3)cc(I)c1O |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 1401801a 81805208 20301100 11810e10 040810e1 00100000 23007000 0900300d 80400980 10090ac0 68218008 5001b800 070098e2 02300800 c10b0480 000c201c 10020200 8e000022 80480118 40030a01 80030c40 18218e00 230040c1 93400418 00041001 e1000601 18224000 d0000000 04000085 00c6000b 602c6004 a000a608 |