On Target SCN9A_HUMAN 0.55128205/CHEMBL2164396
For the given ligand ghj456, we have found in our database that, being scored 0.55128205, the most similar ligand is CHEMBL2164396. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL2164396 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | O=C(NCc1ccc(OCCC(F)(F)F)nc1)C1c2ccccc2C(=O)N1CCc1ccccn1 |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 1400800a 0180b818 2890412a 14010610 80041020 02008100 04044080 0200500c 00010280 00090a40 09248004 4080b000 03808882 00202000 e1023501 021c200c 10022210 0a000004 00200000 00020200 c0820040 38228ec0 21804001 8350001c 00041000 c0200100 082240c0 90002000 0c400304 01060003 a0046000 a4000600 |