On Target 5HT1B_HUMAN 0.42857143/CHEMBL1242623
For the given ligand ghj456, we have found in our database that, being scored 0.42857143, the most similar ligand is CHEMBL1242623. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL1242623 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | Cc1ccc2c(N3CCN(CCc4cccc5c4OCc4c(C(=O)N6CCCCC6)ncn4-5)CC3)cccc2n1 |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 14004002 01801808 22124128 14310e10 80041060 80108140 1200c000 2802b205 10404380 400c0ac0 482d800c 50018880 0080b802 00753200 01060441 020e600e 9c068018 83008022 88610500 40020201 c0120040 38258f08 a1804061 8350111e 00044000 c9008460 0800c0c8 90000084 0c408305 10460003 e0040004 80008640 |