On Target TLR4_HUMAN 0.354717/CHEMBL4462366
For the given ligand ghj456, we have found in our database that, being scored 0.354717, the most similar ligand is CHEMBL4462366. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL4462366 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | CC(C)C[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](N)Cc1cnc[nH]1)C(=O)NCC(=O)O |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 04010002 01007a00 00100100 45810e10 040412c0 00000000 00002020 2000200c 00600b80 00090ac2 28308004 5003b800 1e009812 00502801 811a0040 001c000c 10000000 0e000000 00a00418 40000201 60000d00 38258e28 23800083 93500018 00043801 80000200 48000000 10000100 0c000014 0046000b e00c4200 20002620 |