On Target MTOR_HUMAN 0.42123288/CHEMBL590357
For the given ligand ghj456, we have found in our database that, being scored 0.42123288, the most similar ligand is CHEMBL590357. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL590357 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | CCn1nnc2c(N3CCOCC3)nc(-c3ccc(NC(=O)Nc4ccc(C(=O)NCCc5ccccn5)cc4)cc3)nc21 |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 0401c00f 82001838 e01071a0 98090f60 010c00e0 0000c004 04809200 0208380d 50000180 10080ac0 082da00c 40819800 06009826 00908001 710216c9 120c010c 10040080 0a006008 08600000 00662200 c0120100 3836a640 33827044 8140001c 00303c02 c0000200 18040040 800050a0 0600830d 00460c03 e0041800 2c24c6c8 |