On Target OPRX_HUMAN 0.4892704/CHEMBL3349258
For the given ligand ghj456, we have found in our database that, being scored 0.4892704, the most similar ligand is CHEMBL3349258. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL3349258 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | COc1cccc([C@@]2(CNC(C)=O)C[C@@H]3CC[C@H](C2)N3C(c2ccccc2Cl)c2ccccc2Cl)n1 |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 0400800a 01001218 2030412a 10010600 80041020 00000110 05000020 2300100c 00200880 80080ac0 08308004 50838800 02008886 00206000 23020501 0214000c 10000000 0e000000 00202008 00020201 60120d00 18248710 20800000 81500018 00003000 e0000200 00000040 d0001180 04000386 0086000b 3c060000 24022600 |