On Target FYN_HUMAN 0.36032388/CHEMBL1973363
For the given ligand ghj456, we have found in our database that, being scored 0.36032388, the most similar ligand is CHEMBL1973363. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL1973363 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | COc1cccc(NC(=O)N2CCC(c3nc4c(C(N)=O)cccc4[nH]3)CC2)c1 |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 0000000e 81001808 20100508 10050e10 10041060 00004000 02004024 20003005 00000100 000008d0 41288004 50818000 00009882 08508000 010200c1 020c000c 00040108 06400000 08200008 40022601 e0000100 18078620 21822000 0050011c 00154000 80000000 00000040 10000180 00008204 00c60801 c00c0000 a00242a0 |