On Target TRXR1_HUMAN 0.24497992/CHEMBL4459518
For the given ligand ghj456, we have found in our database that, being scored 0.24497992, the most similar ligand is CHEMBL4459518. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL4459518 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | CN(CCOC(=O)/C=C/C(=O)c1ccc(F)cc1)C(C(=O)NC(C)(C)C)c1ccc(F)cc1 |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 00000008 00000800 00100300 86010600 00000080 00800810 02000001 02001400 01000080 00980840 48200000 4000b000 03008802 00003002 40301408 00080008 10060000 02100180 20210010 00100a00 00000100 38228e80 12008000 8340001c 00001400 c4004400 00400000 80000001 0c000300 00068003 84046000 00000610 |