On Target ESR1_HUMAN 0.44339624/CHEMBL3925390
For the given ligand ghj456, we have found in our database that, being scored 0.44339624, the most similar ligand is CHEMBL3925390. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL3925390 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | COc1ccc(CN(Cc2ccc(C(=O)N3CCc4ccc(O)cc4C3)cc2)Cc2ccccn2)cc1 |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 0000000a 44801808 20104108 50010e00 00041020 00100000 02040000 02003005 00000180 00080840 08210004 40008000 80008882 00200000 01020481 0204010c 00002200 02000022 00200000 00020200 c0020000 18228600 20804000 8144001c 00100000 c0000000 00324040 80000000 04000304 00060003 a0040000 00004600 |