On Target 5HT2C_HUMAN 0.43382353/CHEMBL56508
For the given ligand ghj456, we have found in our database that, being scored 0.43382353, the most similar ligand is CHEMBL56508. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL56508 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | Cc1cc2c(cc1C(F)(F)F)N(C(=O)Nc1cnc(Oc3cccnc3C)c(Cl)c1)CC2 |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 0000c006 00801838 60104108 12010e60 a4041021 0a000106 04080404 00e0200d 00000104 c0080850 08280024 40049804 0600982e 0f308001 21020143 021c200c 10048008 02400028 88202108 00024054 45520100 18318700 20822000 8150a019 01152c02 c0008a00 00040550 90205080 04408324 00460003 80120400 24024680 |