On Target PTGES_HUMAN 0.4180328/CHEMBL181236
For the given ligand ghj456, we have found in our database that, being scored 0.4180328, the most similar ligand is CHEMBL181236. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL181236 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | CC(C)c1ccc2c(c1)c(C(=O)CC(C)(C)C)c(CC(C)(C)C(=O)O)n2Cc1ccc(Cl)cc1 |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 0000800a 01805a00 00101102 50810618 00045121 00008002 01003000 00001005 80500900 100808c0 08108004 50819800 0e008864 00608800 00030060 0a0c000c 00000000 86800004 00680418 00010001 c0400100 18068b58 218040c0 8150041c 00043801 c0000001 08040040 10000000 04400004 0086004a 80040200 20020420 |