On Target MIF_HUMAN 0.3209169/CHEMBL4208992
For the given ligand ghj456, we have found in our database that, being scored 0.3209169, the most similar ligand is CHEMBL4208992. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL4208992 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | O=C(CCCOc1ccc2nc(-c3cn(-c4ccc(O)c(F)c4)nn3)ccc2c1)NCCCCCNC(=S)Nc1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 04040007 41011818 60104108 5a898f10 20141030 0a00c01c 42180444 25303a01 00002504 100848f0 88208004 60019840 04809886 08619000 11030061 920c200c 00070840 82403b00 8c652100 80463a05 40460340 381f8f68 21825048 8750401c 00352403 e0202200 305e0240 502020c1 2762c38c 10068403 d20e5618 1f016e08 |