On Target 5HT2B_HUMAN 0.4891775/CHEMBL15245
For the given ligand ghj456, we have found in our database that, being scored 0.4891775, the most similar ligand is CHEMBL15245. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL15245 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | COC(=O)[C@H]1[C@@H](O)CC[C@H]2CN3CCc4c([nH]c5ccccc45)[C@@H]3C[C@@H]21 |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 0001000a 0100c800 00100102 51010f10 000c1020 00100002 01002000 22003001 00400880 010908c0 08318004 50819000 1400889a 01e08000 00020460 020c010c 00820200 06000026 03602408 00000201 40120100 18218a18 21804000 91500010 00142000 c0000001 08004000 90000080 04000306 00860002 20060200 20006620 |