On Target MK03_HUMAN 0.4261745/CHEMBL4537788
For the given ligand ghj456, we have found in our database that, being scored 0.4261745, the most similar ligand is CHEMBL4537788. Check out the elaboration below.
| ghj456 (Given Ligand) | CHEMBL4537788 (Similar Ligand) |
|---|---|
| CCN(CC)Cc5cccc(C34CCC(CCOc2ncc(C(=O)NCCc1cccc(C(=O)NC)c1)cc2Cl)C3COC(=O)C4)n5 | O=C(NCc1ncc(C(F)(F)F)cc1Cl)c1ccc2c(c1)C1(CCS(=O)(=O)CC1)[C@H](C1CC1)N2S(=O)(=O)c1ccc(F)cc1 |
|
|
|
|
|
|
| 1401804a 09809818 2010410b 10410f10 800c1021 02108102 15044000 02407005 00010a80 00080a48 09358004 50819800 0680882a 02a00000 b1020701 0a1c310c 10828000 06000026 00e02418 00020241 c0120160 18268f00 218000c0 8140001c 00140c00 c2008a00 08220040 80003080 04400306 01860803 a0060080 a4024600 | 0000c056 25808800 01104902 93b10e10 200c1021 001021d0 11014c00 02403001 04200900 00484ad0 48312004 60068800 86058c0b 8b249001 846a0540 0a0e010e 0406a020 02000006 08602408 00006c01 e0100900 18a28f01 21840340 9964001d 06540882 c0000204 08000340 9000118d 04488506 20068033 88160080 21034670 |