On Target HPGDS_HUMAN 0.36683416/CHEMBL264951
For the given ligand ok, we have found in our database that, being scored 0.36683416, the most similar ligand is CHEMBL264951. Check out the elaboration below.
| ok (Given Ligand) | CHEMBL264951 (Similar Ligand) |
|---|---|
| COc4ccc(c3cc1nccn1c(Nc2ccccc2C(N)=O)n3)cc4OC | COc1ccccc1c2csc(Nc3ccc(cc3)C(=O)O)n2 |
|
|
|
|
|
|
| 0000a20a 40800808 a0080108 08850600 01001044 0001c000 0204a000 00081800 00c00100 00000840 01208004 60009800 8600c832 00100000 01060041 080c800c 08060040 12006000 0cc90008 10a23200 40000000 4c02a640 b1806840 0040010c 00000000 80000000 00028000 000110e0 0000c20c 00461808 c0041800 400000a2 | 00070002 00000808 a0000908 80090200 01001000 00004000 42000100 100a8088 00004300 00004840 80200a04 50008000 0400800a 00108001 01022041 000c200c 00068000 12106080 0c000018 30a20000 40000000 08022aa0 a0004800 80410005 00801080 8c100000 30200000 000104e4 0014c30c 140e2000 e0000800 04010002 |